C18H23ClN2O3 — CID 69358558
benzyl N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]carbamate;hydrochloride (PubChem CID 69358558) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is benzyl N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 69358558 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | benzyl N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]carbamate;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1ccccc1)[C@H](O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H22N2O3.ClH/c19-16(11-14-7-3-1-4-8-14)17(21)12-20-18(22)23-13-15-9-5-2-6-10-15;/h1-10,16-17,21H,11-13,19H2,(H,20,22);1H/t16-,17+;/m0./s1 |
| InChIKey | OOCFNZSHIKGQTE-MCJVGQIASA-N |
| XLogP | 2.27 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |