C20H25ClN2O5 — CID 14037134
benzyl 2-amino-3-hydroxy-5-(phenylmethoxycarbonylamino)pentanoate;hydrochloride (PubChem CID 14037134) has the molecular formula C20H25ClN2O5 and a molecular weight of 408.88 g/mol. Its IUPAC name is benzyl 2-amino-3-hydroxy-5-(phenylmethoxycarbonylamino)pentanoate;hydrochloride.
| Compound Name | benzyl 2-amino-3-hydroxy-5-(phenylmethoxycarbonylamino)pentanoate;hydrochloride |
|---|---|
| PubChem CID | 14037134 |
| Molecular Formula | C20H25ClN2O5 |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | benzyl 2-amino-3-hydroxy-5-(phenylmethoxycarbonylamino)pentanoate;hydrochloride |
| SMILES | Cl.NC(C(=O)OCc1ccccc1)C(O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H24N2O5.ClH/c21-18(19(24)26-13-15-7-3-1-4-8-15)17(23)11-12-22-20(25)27-14-16-9-5-2-6-10-16;/h1-10,17-18,23H,11-14,21H2,(H,22,25);1H |
| InChIKey | RFFLYNQKLPUESF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |