C14H19NO6 — CID 15953376
benzyl N-[(3R,4S)-3,4,6-trihydroxy-5-oxohexyl]carbamate (PubChem CID 15953376) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is benzyl N-[(3R,4S)-3,4,6-trihydroxy-5-oxohexyl]carbamate.
| Compound Name | benzyl N-[(3R,4S)-3,4,6-trihydroxy-5-oxohexyl]carbamate |
|---|---|
| PubChem CID | 15953376 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | benzyl N-[(3R,4S)-3,4,6-trihydroxy-5-oxohexyl]carbamate |
| SMILES | O=C(NCC[C@@H](O)[C@H](O)C(=O)CO)OCc1ccccc1 |
| InChI | InChI=1S/C14H19NO6/c16-8-12(18)13(19)11(17)6-7-15-14(20)21-9-10-4-2-1-3-5-10/h1-5,11,13,16-17,19H,6-9H2,(H,15,20)/t11-,13+/m1/s1 |
| InChIKey | NNFRVRHUZOYOAH-YPMHNXCESA-N |
| XLogP | -0.41 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |