C19H22N2O6 — CID 171888884
4-amino-3-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]benzoic acid (PubChem CID 171888884) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is 4-amino-3-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]benzoic acid.
| Compound Name | 4-amino-3-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]benzoic acid |
|---|---|
| PubChem CID | 171888884 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 4-amino-3-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]benzoic acid |
| SMILES | Nc1ccc(C(=O)O)cc1C(O)C(O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O6/c20-15-7-6-13(18(24)25)10-14(15)17(23)16(22)8-9-21-19(26)27-11-12-4-2-1-3-5-12/h1-7,10,16-17,22-23H,8-9,11,20H2,(H,21,26)(H,24,25) |
| InChIKey | WGWIKIOQPUYYSC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|