C18H19Cl2NO4 — CID 171887986
benzyl N-[4-(2,5-dichlorophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171887986) has the molecular formula C18H19Cl2NO4 and a molecular weight of 384.26 g/mol. Its IUPAC name is benzyl N-[4-(2,5-dichlorophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(2,5-dichlorophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171887986 |
| Molecular Formula | C18H19Cl2NO4 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | benzyl N-[4-(2,5-dichlorophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1cc(Cl)ccc1Cl)OCc1ccccc1 |
| InChI | InChI=1S/C18H19Cl2NO4/c19-13-6-7-15(20)14(10-13)17(23)16(22)8-9-21-18(24)25-11-12-4-2-1-3-5-12/h1-7,10,16-17,22-23H,8-9,11H2,(H,21,24) |
| InChIKey | GNGQPTXEDSALTG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |