C17H19ClN2O5 — CID 171888191
benzyl N-[4-(5-chloro-2-oxo-1H-pyridin-3-yl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888191) has the molecular formula C17H19ClN2O5 and a molecular weight of 366.80 g/mol. Its IUPAC name is benzyl N-[4-(5-chloro-2-oxo-1H-pyridin-3-yl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(5-chloro-2-oxo-1H-pyridin-3-yl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888191 |
| Molecular Formula | C17H19ClN2O5 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | benzyl N-[4-(5-chloro-2-oxo-1H-pyridin-3-yl)-3,4-dihydroxybutyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1cc(Cl)c[nH]c1=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H19ClN2O5/c18-12-8-13(16(23)20-9-12)15(22)14(21)6-7-19-17(24)25-10-11-4-2-1-3-5-11/h1-5,8-9,14-15,21-22H,6-7,10H2,(H,19,24)(H,20,23) |
| InChIKey | XECVXCFXWGVPKY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |