C18H18F3NO4 — CID 171888246
benzyl N-[3,4-dihydroxy-4-(2,3,5-trifluorophenyl)butyl]carbamate (PubChem CID 171888246) has the molecular formula C18H18F3NO4 and a molecular weight of 369.34 g/mol. Its IUPAC name is benzyl N-[3,4-dihydroxy-4-(2,3,5-trifluorophenyl)butyl]carbamate.
| Compound Name | benzyl N-[3,4-dihydroxy-4-(2,3,5-trifluorophenyl)butyl]carbamate |
|---|---|
| PubChem CID | 171888246 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | benzyl N-[3,4-dihydroxy-4-(2,3,5-trifluorophenyl)butyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1cc(F)cc(F)c1F)OCc1ccccc1 |
| InChI | InChI=1S/C18H18F3NO4/c19-12-8-13(16(21)14(20)9-12)17(24)15(23)6-7-22-18(25)26-10-11-4-2-1-3-5-11/h1-5,8-9,15,17,23-24H,6-7,10H2,(H,22,25) |
| InChIKey | QGYHHUZKLAFABC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|