C19H20FNO5 — CID 171888337
benzyl N-[4-(2-fluoro-3-formylphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888337) has the molecular formula C19H20FNO5 and a molecular weight of 361.37 g/mol. Its IUPAC name is benzyl N-[4-(2-fluoro-3-formylphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(2-fluoro-3-formylphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888337 |
| Molecular Formula | C19H20FNO5 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | benzyl N-[4-(2-fluoro-3-formylphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | O=Cc1cccc(C(O)C(O)CCNC(=O)OCc2ccccc2)c1F |
| InChI | InChI=1S/C19H20FNO5/c20-17-14(11-22)7-4-8-15(17)18(24)16(23)9-10-21-19(25)26-12-13-5-2-1-3-6-13/h1-8,11,16,18,23-24H,9-10,12H2,(H,21,25) |
| InChIKey | TWHCHBHCGMYDAK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|