C18H22N2O5 — CID 171888220
benzyl N-[4-(3-amino-2-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888220) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is benzyl N-[4-(3-amino-2-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(3-amino-2-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888220 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | benzyl N-[4-(3-amino-2-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | Nc1cccc(C(O)C(O)CCNC(=O)OCc2ccccc2)c1O |
| InChI | InChI=1S/C18H22N2O5/c19-14-8-4-7-13(16(14)22)17(23)15(21)9-10-20-18(24)25-11-12-5-2-1-3-6-12/h1-8,15,17,21-23H,9-11,19H2,(H,20,24) |
| InChIKey | HHUCICAPAMKBBN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|