benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate

C19H21N3O4 — CID 171888590

IUPACbenzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate
SMILESO=C(NCCC(O)C(O)c1cccc2[nH]ncc12)OCc1ccccc1
InChIInChI=1S/C19H21N3O4/c23-17(18(24)14-7-4-8-16-15(14)11-21-22-16)9-10-20-19(25)26-12-13-5-2-1-3-6-13/h1-8,11,17-18,23-24H,9-10,12H2,(H,20,25)(H,21,22)
InChIKeyBTNMRQKVSJSKRP-UHFFFAOYSA-N
MW355.39 g/mol
LogP2.27
Rot. Bonds7

About benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate

benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate (PubChem CID 171888590) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate.

Molecular Properties

Compound Namebenzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate
PubChem CID171888590
Molecular FormulaC19H21N3O4
Molecular Weight355.39 g/mol
Exact Mass355.15
IUPAC Namebenzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate
SMILESO=C(NCCC(O)C(O)c1cccc2[nH]ncc12)OCc1ccccc1
InChIInChI=1S/C19H21N3O4/c23-17(18(24)14-7-4-8-16-15(14)11-21-22-16)9-10-20-19(25)26-12-13-5-2-1-3-6-13/h1-8,11,17-18,23-24H,9-10,12H2,(H,20,25)(H,21,22)
InChIKeyBTNMRQKVSJSKRP-UHFFFAOYSA-N
XLogP2.27
TPSA107.47 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500355.39
LogP ≤ 52.27
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate?
The IUPAC name of benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate (CID 171888590) is benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate.
What is the SMILES notation for benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate?
The canonical SMILES for benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate is O=C(NCCC(O)C(O)c1cccc2[nH]ncc12)OCc1ccccc1.
What is the InChIKey of benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate?
The InChIKey is BTNMRQKVSJSKRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O4/c23-17(18(24)14-7-4-8-16-15(14)11-21-22-16)9-10-20-19(25)26-12-13-5-2-1-3-6-13/h1-8,11,17-18,23-24H,9-10,12H2,(H,20,25)(H,21,22).
What are the key properties of benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate?
benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate has a molecular weight of 355.39 g/mol, XLogP of 2.27, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[3,4-dihydroxy-4-(1H-indazol-4-yl)butyl]carbamate is sourced from PubChem (CID 171888590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).