C19H23NO6S — CID 171888702
benzyl N-[3,4-dihydroxy-4-(2-methylsulfonylphenyl)butyl]carbamate (PubChem CID 171888702) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is benzyl N-[3,4-dihydroxy-4-(2-methylsulfonylphenyl)butyl]carbamate.
| Compound Name | benzyl N-[3,4-dihydroxy-4-(2-methylsulfonylphenyl)butyl]carbamate |
|---|---|
| PubChem CID | 171888702 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | benzyl N-[3,4-dihydroxy-4-(2-methylsulfonylphenyl)butyl]carbamate |
| SMILES | CS(=O)(=O)c1ccccc1C(O)C(O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H23NO6S/c1-27(24,25)17-10-6-5-9-15(17)18(22)16(21)11-12-20-19(23)26-13-14-7-3-2-4-8-14/h2-10,16,18,21-22H,11-13H2,1H3,(H,20,23) |
| InChIKey | CYCAPYRDCWARDH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |