C18H21NO6S — CID 171856199
benzyl N-[2,3-dihydroxy-3-(2-methylsulfonylphenyl)propyl]carbamate (PubChem CID 171856199) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is benzyl N-[2,3-dihydroxy-3-(2-methylsulfonylphenyl)propyl]carbamate.
| Compound Name | benzyl N-[2,3-dihydroxy-3-(2-methylsulfonylphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 171856199 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | benzyl N-[2,3-dihydroxy-3-(2-methylsulfonylphenyl)propyl]carbamate |
| SMILES | CS(=O)(=O)c1ccccc1C(O)C(O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H21NO6S/c1-26(23,24)16-10-6-5-9-14(16)17(21)15(20)11-19-18(22)25-12-13-7-3-2-4-8-13/h2-10,15,17,20-21H,11-12H2,1H3,(H,19,22) |
| InChIKey | TZADCUGUNNOPJI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |