C18H20N2O8S — CID 171856879
benzyl N-[2,3-dihydroxy-3-(4-methylsulfonyl-2-nitrophenyl)propyl]carbamate (PubChem CID 171856879) has the molecular formula C18H20N2O8S and a molecular weight of 424.43 g/mol. Its IUPAC name is benzyl N-[2,3-dihydroxy-3-(4-methylsulfonyl-2-nitrophenyl)propyl]carbamate.
| Compound Name | benzyl N-[2,3-dihydroxy-3-(4-methylsulfonyl-2-nitrophenyl)propyl]carbamate |
|---|---|
| PubChem CID | 171856879 |
| Molecular Formula | C18H20N2O8S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | benzyl N-[2,3-dihydroxy-3-(4-methylsulfonyl-2-nitrophenyl)propyl]carbamate |
| SMILES | CS(=O)(=O)c1ccc(C(O)C(O)CNC(=O)OCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H20N2O8S/c1-29(26,27)13-7-8-14(15(9-13)20(24)25)17(22)16(21)10-19-18(23)28-11-12-5-3-2-4-6-12/h2-9,16-17,21-22H,10-11H2,1H3,(H,19,23) |
| InChIKey | MQUFROOYCPJRDZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 156.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|