C16H19N3O4 — CID 171887825
benzyl N-(3,4-dihydroxy-4-pyrimidin-5-ylbutyl)carbamate (PubChem CID 171887825) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is benzyl N-(3,4-dihydroxy-4-pyrimidin-5-ylbutyl)carbamate.
| Compound Name | benzyl N-(3,4-dihydroxy-4-pyrimidin-5-ylbutyl)carbamate |
|---|---|
| PubChem CID | 171887825 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | benzyl N-(3,4-dihydroxy-4-pyrimidin-5-ylbutyl)carbamate |
| SMILES | O=C(NCCC(O)C(O)c1cncnc1)OCc1ccccc1 |
| InChI | InChI=1S/C16H19N3O4/c20-14(15(21)13-8-17-11-18-9-13)6-7-19-16(22)23-10-12-4-2-1-3-5-12/h1-5,8-9,11,14-15,20-21H,6-7,10H2,(H,19,22) |
| InChIKey | YYDNSRGBXCBKLW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |