C19H20N2O4 — CID 171888151
benzyl N-[4-(4-cyanophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888151) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is benzyl N-[4-(4-cyanophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(4-cyanophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888151 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | benzyl N-[4-(4-cyanophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | N#Cc1ccc(C(O)C(O)CCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O4/c20-12-14-6-8-16(9-7-14)18(23)17(22)10-11-21-19(24)25-13-15-4-2-1-3-5-15/h1-9,17-18,22-23H,10-11,13H2,(H,21,24) |
| InChIKey | HEZNKRRHHPNCQT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |