C19H20N2O5 — CID 171888535
benzyl N-[4-(3-cyano-4-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888535) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is benzyl N-[4-(3-cyano-4-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(3-cyano-4-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888535 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | benzyl N-[4-(3-cyano-4-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | N#Cc1cc(C(O)C(O)CCNC(=O)OCc2ccccc2)ccc1O |
| InChI | InChI=1S/C19H20N2O5/c20-11-15-10-14(6-7-16(15)22)18(24)17(23)8-9-21-19(25)26-12-13-4-2-1-3-5-13/h1-7,10,17-18,22-24H,8-9,12H2,(H,21,25) |
| InChIKey | WFEQAKYZOOVKRX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 122.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |