C19H19N3O6 — CID 171889064
benzyl N-[4-(4-cyano-3-nitrophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171889064) has the molecular formula C19H19N3O6 and a molecular weight of 385.38 g/mol. Its IUPAC name is benzyl N-[4-(4-cyano-3-nitrophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(4-cyano-3-nitrophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171889064 |
| Molecular Formula | C19H19N3O6 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | benzyl N-[4-(4-cyano-3-nitrophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | N#Cc1ccc(C(O)C(O)CCNC(=O)OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19N3O6/c20-11-15-7-6-14(10-16(15)22(26)27)18(24)17(23)8-9-21-19(25)28-12-13-4-2-1-3-5-13/h1-7,10,17-18,23-24H,8-9,12H2,(H,21,25) |
| InChIKey | CWKGSKKPYNKSMR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 145.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|