C20H22N2O8 — CID 171889386
methyl 3-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]-5-nitrobenzoate (PubChem CID 171889386) has the molecular formula C20H22N2O8 and a molecular weight of 418.40 g/mol. Its IUPAC name is methyl 3-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 171889386 |
| Molecular Formula | C20H22N2O8 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | methyl 3-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(O)C(O)CCNC(=O)OCc2ccccc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H22N2O8/c1-29-19(25)15-9-14(10-16(11-15)22(27)28)18(24)17(23)7-8-21-20(26)30-12-13-5-3-2-4-6-13/h2-6,9-11,17-18,23-24H,7-8,12H2,1H3,(H,21,26) |
| InChIKey | PPESLILANJRNLZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|