C18H21N3O7 — CID 171889073
benzyl N-[3,4-dihydroxy-4-(2-methoxy-5-nitro-3-pyridinyl)butyl]carbamate (PubChem CID 171889073) has the molecular formula C18H21N3O7 and a molecular weight of 391.38 g/mol. Its IUPAC name is benzyl N-[3,4-dihydroxy-4-(2-methoxy-5-nitro-3-pyridinyl)butyl]carbamate.
| Compound Name | benzyl N-[3,4-dihydroxy-4-(2-methoxy-5-nitro-3-pyridinyl)butyl]carbamate |
|---|---|
| PubChem CID | 171889073 |
| Molecular Formula | C18H21N3O7 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | benzyl N-[3,4-dihydroxy-4-(2-methoxy-5-nitro-3-pyridinyl)butyl]carbamate |
| SMILES | COc1ncc([N+](=O)[O-])cc1C(O)C(O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H21N3O7/c1-27-17-14(9-13(10-20-17)21(25)26)16(23)15(22)7-8-19-18(24)28-11-12-5-3-2-4-6-12/h2-6,9-10,15-16,22-23H,7-8,11H2,1H3,(H,19,24) |
| InChIKey | QENCTGCWROHHEB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|