C18H19N3O7 — CID 171856826
benzyl N-[3-(3-carbamoyl-5-nitrophenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171856826) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is benzyl N-[3-(3-carbamoyl-5-nitrophenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(3-carbamoyl-5-nitrophenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171856826 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | benzyl N-[3-(3-carbamoyl-5-nitrophenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | NC(=O)c1cc(C(O)C(O)CNC(=O)OCc2ccccc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N3O7/c19-17(24)13-6-12(7-14(8-13)21(26)27)16(23)15(22)9-20-18(25)28-10-11-4-2-1-3-5-11/h1-8,15-16,22-23H,9-10H2,(H2,19,24)(H,20,25) |
| InChIKey | SPMKUZHPHCJTNB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|