C18H21N3O5 — CID 171856317
benzyl N-[3-[4-(hydrazinecarbonyl)phenyl]-2,3-dihydroxypropyl]carbamate (PubChem CID 171856317) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is benzyl N-[3-[4-(hydrazinecarbonyl)phenyl]-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-[4-(hydrazinecarbonyl)phenyl]-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171856317 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | benzyl N-[3-[4-(hydrazinecarbonyl)phenyl]-2,3-dihydroxypropyl]carbamate |
| SMILES | NNC(=O)c1ccc(C(O)C(O)CNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21N3O5/c19-21-17(24)14-8-6-13(7-9-14)16(23)15(22)10-20-18(25)26-11-12-4-2-1-3-5-12/h1-9,15-16,22-23H,10-11,19H2,(H,20,25)(H,21,24) |
| InChIKey | CUSJQDMRGUGNIC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|