C21H20F3NO6 — CID 171856951
benzyl N-[2,3-dihydroxy-3-[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]propyl]carbamate (PubChem CID 171856951) has the molecular formula C21H20F3NO6 and a molecular weight of 439.39 g/mol. Its IUPAC name is benzyl N-[2,3-dihydroxy-3-[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]propyl]carbamate.
| Compound Name | benzyl N-[2,3-dihydroxy-3-[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 171856951 |
| Molecular Formula | C21H20F3NO6 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | benzyl N-[2,3-dihydroxy-3-[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]propyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1ccc(C(=O)CC(=O)C(F)(F)F)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C21H20F3NO6/c22-21(23,24)18(28)10-16(26)14-6-8-15(9-7-14)19(29)17(27)11-25-20(30)31-12-13-4-2-1-3-5-13/h1-9,17,19,27,29H,10-12H2,(H,25,30) |
| InChIKey | CGOFRDMVQFXEDF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|