C17H18FNO6S — CID 171856238
benzyl N-[3-(4-fluorosulfonylphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171856238) has the molecular formula C17H18FNO6S and a molecular weight of 383.40 g/mol. Its IUPAC name is benzyl N-[3-(4-fluorosulfonylphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(4-fluorosulfonylphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171856238 |
| Molecular Formula | C17H18FNO6S |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | benzyl N-[3-(4-fluorosulfonylphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1ccc(S(=O)(=O)F)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C17H18FNO6S/c18-26(23,24)14-8-6-13(7-9-14)16(21)15(20)10-19-17(22)25-11-12-4-2-1-3-5-12/h1-9,15-16,20-21H,10-11H2,(H,19,22) |
| InChIKey | WABPNPQHULAUMP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |