C20H21N3O4 — CID 171856680
benzyl N-[2,3-dihydroxy-3-(4-pyrazol-1-ylphenyl)propyl]carbamate (PubChem CID 171856680) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is benzyl N-[2,3-dihydroxy-3-(4-pyrazol-1-ylphenyl)propyl]carbamate.
| Compound Name | benzyl N-[2,3-dihydroxy-3-(4-pyrazol-1-ylphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 171856680 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | benzyl N-[2,3-dihydroxy-3-(4-pyrazol-1-ylphenyl)propyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1ccc(-n2cccn2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C20H21N3O4/c24-18(13-21-20(26)27-14-15-5-2-1-3-6-15)19(25)16-7-9-17(10-8-16)23-12-4-11-22-23/h1-12,18-19,24-25H,13-14H2,(H,21,26) |
| InChIKey | YIXAHMFREUFORY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |