C14H16N2O4 — CID 171896348
methyl 3,4-dihydroxy-4-(4-pyrazol-1-ylphenyl)butanoate (PubChem CID 171896348) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(4-pyrazol-1-ylphenyl)butanoate.
| Compound Name | methyl 3,4-dihydroxy-4-(4-pyrazol-1-ylphenyl)butanoate |
|---|---|
| PubChem CID | 171896348 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | methyl 3,4-dihydroxy-4-(4-pyrazol-1-ylphenyl)butanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C14H16N2O4/c1-20-13(18)9-12(17)14(19)10-3-5-11(6-4-10)16-8-2-7-15-16/h2-8,12,14,17,19H,9H2,1H3 |
| InChIKey | PDBWFYWRCSFUAC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |