C23H24N2O4 — CID 171856903
benzyl N-[3-(3-anilinophenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171856903) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is benzyl N-[3-(3-anilinophenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(3-anilinophenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171856903 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | benzyl N-[3-(3-anilinophenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1cccc(Nc2ccccc2)c1)OCc1ccccc1 |
| InChI | InChI=1S/C23H24N2O4/c26-21(15-24-23(28)29-16-17-8-3-1-4-9-17)22(27)18-10-7-13-20(14-18)25-19-11-5-2-6-12-19/h1-14,21-22,25-27H,15-16H2,(H,24,28) |
| InChIKey | FBAFYGMIAICTCT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |