C18H21N3O4S — CID 171856289
benzyl N-[3-[3-(carbamothioylamino)phenyl]-2,3-dihydroxypropyl]carbamate (PubChem CID 171856289) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is benzyl N-[3-[3-(carbamothioylamino)phenyl]-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-[3-(carbamothioylamino)phenyl]-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171856289 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | benzyl N-[3-[3-(carbamothioylamino)phenyl]-2,3-dihydroxypropyl]carbamate |
| SMILES | NC(=S)Nc1cccc(C(O)C(O)CNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H21N3O4S/c19-17(26)21-14-8-4-7-13(9-14)16(23)15(22)10-20-18(24)25-11-12-5-2-1-3-6-12/h1-9,15-16,22-23H,10-11H2,(H,20,24)(H3,19,21,26) |
| InChIKey | KVQQQKNQXZRWEK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|