C20H25NO6 — CID 171857173
benzyl N-[3-(3-ethoxy-4-methoxyphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171857173) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is benzyl N-[3-(3-ethoxy-4-methoxyphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(3-ethoxy-4-methoxyphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171857173 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | benzyl N-[3-(3-ethoxy-4-methoxyphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CCOc1cc(C(O)C(O)CNC(=O)OCc2ccccc2)ccc1OC |
| InChI | InChI=1S/C20H25NO6/c1-3-26-18-11-15(9-10-17(18)25-2)19(23)16(22)12-21-20(24)27-13-14-7-5-4-6-8-14/h4-11,16,19,22-23H,3,12-13H2,1-2H3,(H,21,24) |
| InChIKey | AZOMDNNCSDNQSE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |