C20H24N2O5 — CID 171888918
benzyl N-[3,4-dihydroxy-4-[4-(methylcarbamoyl)phenyl]butyl]carbamate (PubChem CID 171888918) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is benzyl N-[3,4-dihydroxy-4-[4-(methylcarbamoyl)phenyl]butyl]carbamate.
| Compound Name | benzyl N-[3,4-dihydroxy-4-[4-(methylcarbamoyl)phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 171888918 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | benzyl N-[3,4-dihydroxy-4-[4-(methylcarbamoyl)phenyl]butyl]carbamate |
| SMILES | CNC(=O)c1ccc(C(O)C(O)CCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O5/c1-21-19(25)16-9-7-15(8-10-16)18(24)17(23)11-12-22-20(26)27-13-14-5-3-2-4-6-14/h2-10,17-18,23-24H,11-13H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | YGIWUHNZQGHPDS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |