C22H29NO4 — CID 171888676
benzyl N-[4-(4-butylphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888676) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is benzyl N-[4-(4-butylphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(4-butylphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888676 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | benzyl N-[4-(4-butylphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CCCCc1ccc(C(O)C(O)CCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H29NO4/c1-2-3-7-17-10-12-19(13-11-17)21(25)20(24)14-15-23-22(26)27-16-18-8-5-4-6-9-18/h4-6,8-13,20-21,24-25H,2-3,7,14-16H2,1H3,(H,23,26) |
| InChIKey | OGZNTUIARBLHNP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |