C19H22BrNO4 — CID 171889497
benzyl N-[4-(3-bromo-4-methylphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171889497) has the molecular formula C19H22BrNO4 and a molecular weight of 408.29 g/mol. Its IUPAC name is benzyl N-[4-(3-bromo-4-methylphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(3-bromo-4-methylphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171889497 |
| Molecular Formula | C19H22BrNO4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | benzyl N-[4-(3-bromo-4-methylphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | Cc1ccc(C(O)C(O)CCNC(=O)OCc2ccccc2)cc1Br |
| InChI | InChI=1S/C19H22BrNO4/c1-13-7-8-15(11-16(13)20)18(23)17(22)9-10-21-19(24)25-12-14-5-3-2-4-6-14/h2-8,11,17-18,22-23H,9-10,12H2,1H3,(H,21,24) |
| InChIKey | CMPQADJDIDHVRP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |