C19H24N2O5 — CID 171888534
benzyl N-[4-[4-amino-3-(hydroxymethyl)phenyl]-3,4-dihydroxybutyl]carbamate (PubChem CID 171888534) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is benzyl N-[4-[4-amino-3-(hydroxymethyl)phenyl]-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-[4-amino-3-(hydroxymethyl)phenyl]-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888534 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | benzyl N-[4-[4-amino-3-(hydroxymethyl)phenyl]-3,4-dihydroxybutyl]carbamate |
| SMILES | Nc1ccc(C(O)C(O)CCNC(=O)OCc2ccccc2)cc1CO |
| InChI | InChI=1S/C19H24N2O5/c20-16-7-6-14(10-15(16)11-22)18(24)17(23)8-9-21-19(25)26-12-13-4-2-1-3-5-13/h1-7,10,17-18,22-24H,8-9,11-12,20H2,(H,21,25) |
| InChIKey | DTNCRPPDHIXZNS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|