C16H19N3O5S — CID 171855914
benzyl N-[3-[5-(hydrazinecarbonyl)thiophen-2-yl]-2,3-dihydroxypropyl]carbamate (PubChem CID 171855914) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is benzyl N-[3-[5-(hydrazinecarbonyl)thiophen-2-yl]-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-[5-(hydrazinecarbonyl)thiophen-2-yl]-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855914 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | benzyl N-[3-[5-(hydrazinecarbonyl)thiophen-2-yl]-2,3-dihydroxypropyl]carbamate |
| SMILES | NNC(=O)c1ccc(C(O)C(O)CNC(=O)OCc2ccccc2)s1 |
| InChI | InChI=1S/C16H19N3O5S/c17-19-15(22)13-7-6-12(25-13)14(21)11(20)8-18-16(23)24-9-10-4-2-1-3-5-10/h1-7,11,14,20-21H,8-9,17H2,(H,18,23)(H,19,22) |
| InChIKey | NUAMJKGXXYIKNC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|