C15H16BrNO4S — CID 171857279
benzyl N-[3-(3-bromothiophen-2-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171857279) has the molecular formula C15H16BrNO4S and a molecular weight of 386.27 g/mol. Its IUPAC name is benzyl N-[3-(3-bromothiophen-2-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(3-bromothiophen-2-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171857279 |
| Molecular Formula | C15H16BrNO4S |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | benzyl N-[3-(3-bromothiophen-2-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1sccc1Br)OCc1ccccc1 |
| InChI | InChI=1S/C15H16BrNO4S/c16-11-6-7-22-14(11)13(19)12(18)8-17-15(20)21-9-10-4-2-1-3-5-10/h1-7,12-13,18-19H,8-9H2,(H,17,20) |
| InChIKey | YEXXOALASSVCQL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |