C17H19NO5S — CID 171855517
benzyl N-[3-(5-formyl-3-methylthiophen-2-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171855517) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is benzyl N-[3-(5-formyl-3-methylthiophen-2-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(5-formyl-3-methylthiophen-2-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855517 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | benzyl N-[3-(5-formyl-3-methylthiophen-2-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | Cc1cc(C=O)sc1C(O)C(O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H19NO5S/c1-11-7-13(9-19)24-16(11)15(21)14(20)8-18-17(22)23-10-12-5-3-2-4-6-12/h2-7,9,14-15,20-21H,8,10H2,1H3,(H,18,22) |
| InChIKey | KPFBBPKWEUSFJP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|