C16H19NO4S — CID 171855314
benzyl N-[2,3-dihydroxy-3-(5-methylthiophen-2-yl)propyl]carbamate (PubChem CID 171855314) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is benzyl N-[2,3-dihydroxy-3-(5-methylthiophen-2-yl)propyl]carbamate.
| Compound Name | benzyl N-[2,3-dihydroxy-3-(5-methylthiophen-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 171855314 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | benzyl N-[2,3-dihydroxy-3-(5-methylthiophen-2-yl)propyl]carbamate |
| SMILES | Cc1ccc(C(O)C(O)CNC(=O)OCc2ccccc2)s1 |
| InChI | InChI=1S/C16H19NO4S/c1-11-7-8-14(22-11)15(19)13(18)9-17-16(20)21-10-12-5-3-2-4-6-12/h2-8,13,15,18-19H,9-10H2,1H3,(H,17,20) |
| InChIKey | RQFDPZFEVCSFRN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |