C12H15N3O6 — CID 170830962
3-(3-acetamido-1,2-dihydroxypropyl)-5-nitrobenzamide (PubChem CID 170830962) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is 3-(3-acetamido-1,2-dihydroxypropyl)-5-nitrobenzamide.
| Compound Name | 3-(3-acetamido-1,2-dihydroxypropyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 170830962 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-(3-acetamido-1,2-dihydroxypropyl)-5-nitrobenzamide |
| SMILES | CC(=O)NCC(O)C(O)c1cc(C(N)=O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15N3O6/c1-6(16)14-5-10(17)11(18)7-2-8(12(13)19)4-9(3-7)15(20)21/h2-4,10-11,17-18H,5H2,1H3,(H2,13,19)(H,14,16) |
| InChIKey | WQSHDMHKJKPQOF-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|