C12H14N2O7 — CID 171867002
ethyl 3-(3-carbamoyl-5-nitrophenyl)-2,3-dihydroxypropanoate (PubChem CID 171867002) has the molecular formula C12H14N2O7 and a molecular weight of 298.25 g/mol. Its IUPAC name is ethyl 3-(3-carbamoyl-5-nitrophenyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(3-carbamoyl-5-nitrophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171867002 |
| Molecular Formula | C12H14N2O7 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | ethyl 3-(3-carbamoyl-5-nitrophenyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cc(C(N)=O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14N2O7/c1-2-21-12(18)10(16)9(15)6-3-7(11(13)17)5-8(4-6)14(19)20/h3-5,9-10,15-16H,2H2,1H3,(H2,13,17) |
| InChIKey | RMDQKFZFDLQXQV-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|