C13H15NO8 — CID 171867059
methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-nitrobenzoate (PubChem CID 171867059) has the molecular formula C13H15NO8 and a molecular weight of 313.26 g/mol. Its IUPAC name is methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-nitrobenzoate.
| Compound Name | methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 171867059 |
| Molecular Formula | C13H15NO8 |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-nitrobenzoate |
| SMILES | CCOC(=O)C(O)C(O)c1cc(C(=O)OC)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15NO8/c1-3-22-13(18)11(16)10(15)7-4-8(12(17)21-2)6-9(5-7)14(19)20/h4-6,10-11,15-16H,3H2,1-2H3 |
| InChIKey | ZNRKOANUZQHJDU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|