C12H15NO7 — CID 171873261
methyl 3-nitro-5-(1,2,4-trihydroxybutyl)benzoate (PubChem CID 171873261) has the molecular formula C12H15NO7 and a molecular weight of 285.25 g/mol. Its IUPAC name is methyl 3-nitro-5-(1,2,4-trihydroxybutyl)benzoate.
| Compound Name | methyl 3-nitro-5-(1,2,4-trihydroxybutyl)benzoate |
|---|---|
| PubChem CID | 171873261 |
| Molecular Formula | C12H15NO7 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | methyl 3-nitro-5-(1,2,4-trihydroxybutyl)benzoate |
| SMILES | COC(=O)c1cc(C(O)C(O)CCO)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15NO7/c1-20-12(17)8-4-7(5-9(6-8)13(18)19)11(16)10(15)2-3-14/h4-6,10-11,14-16H,2-3H2,1H3 |
| InChIKey | MJWHUFPGVWTZMV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|