C12H14ClNO6 — CID 171894761
methyl 3-(4-chloro-1,2-dihydroxybutyl)-5-nitrobenzoate (PubChem CID 171894761) has the molecular formula C12H14ClNO6 and a molecular weight of 303.70 g/mol. Its IUPAC name is methyl 3-(4-chloro-1,2-dihydroxybutyl)-5-nitrobenzoate.
| Compound Name | methyl 3-(4-chloro-1,2-dihydroxybutyl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 171894761 |
| Molecular Formula | C12H14ClNO6 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | methyl 3-(4-chloro-1,2-dihydroxybutyl)-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(O)C(O)CCCl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14ClNO6/c1-20-12(17)8-4-7(5-9(6-8)14(18)19)11(16)10(15)2-3-13/h4-6,10-11,15-16H,2-3H2,1H3 |
| InChIKey | JOPGBKLGZIWVFO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|