C11H11ClN2O4 — CID 171894441
3-(4-chloro-1,2-dihydroxybutyl)-5-nitrobenzonitrile (PubChem CID 171894441) has the molecular formula C11H11ClN2O4 and a molecular weight of 270.67 g/mol. Its IUPAC name is 3-(4-chloro-1,2-dihydroxybutyl)-5-nitrobenzonitrile.
| Compound Name | 3-(4-chloro-1,2-dihydroxybutyl)-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 171894441 |
| Molecular Formula | C11H11ClN2O4 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 3-(4-chloro-1,2-dihydroxybutyl)-5-nitrobenzonitrile |
| SMILES | N#Cc1cc(C(O)C(O)CCCl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11ClN2O4/c12-2-1-10(15)11(16)8-3-7(6-13)4-9(5-8)14(17)18/h3-5,10-11,15-16H,1-2H2 |
| InChIKey | WYISIWGFXGIVBS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|