C9H9ClN2O2 — CID 171861687
5-(3-chloro-1,2-dihydroxypropyl)pyridine-3-carbonitrile (PubChem CID 171861687) has the molecular formula C9H9ClN2O2 and a molecular weight of 212.64 g/mol. Its IUPAC name is 5-(3-chloro-1,2-dihydroxypropyl)pyridine-3-carbonitrile.
| Compound Name | 5-(3-chloro-1,2-dihydroxypropyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171861687 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 5-(3-chloro-1,2-dihydroxypropyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(C(O)C(O)CCl)c1 |
| InChI | InChI=1S/C9H9ClN2O2/c10-2-8(13)9(14)7-1-6(3-11)4-12-5-7/h1,4-5,8-9,13-14H,2H2 |
| InChIKey | OBSZADONDIATFH-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|