C10H13N3O2 — CID 171880909
5-(4-amino-1,2-dihydroxybutyl)pyridine-3-carbonitrile (PubChem CID 171880909) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 5-(4-amino-1,2-dihydroxybutyl)pyridine-3-carbonitrile.
| Compound Name | 5-(4-amino-1,2-dihydroxybutyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171880909 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 5-(4-amino-1,2-dihydroxybutyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(C(O)C(O)CCN)c1 |
| InChI | InChI=1S/C10H13N3O2/c11-2-1-9(14)10(15)8-3-7(4-12)5-13-6-8/h3,5-6,9-10,14-15H,1-2,11H2 |
| InChIKey | IQXURNYBBREPCI-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |