C11H13ClN2O2 — CID 171881285
4-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzonitrile (PubChem CID 171881285) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 4-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzonitrile.
| Compound Name | 4-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzonitrile |
|---|---|
| PubChem CID | 171881285 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzonitrile |
| SMILES | N#Cc1ccc(C(O)C(O)CCN)cc1Cl |
| InChI | InChI=1S/C11H13ClN2O2/c12-9-5-7(1-2-8(9)6-14)11(16)10(15)3-4-13/h1-2,5,10-11,15-16H,3-4,13H2 |
| InChIKey | FQRCLZWWOUVFFQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |