C12H16N2O3 — CID 171881743
5-(4-amino-1,2-dihydroxybutyl)-2-methoxybenzonitrile (PubChem CID 171881743) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 5-(4-amino-1,2-dihydroxybutyl)-2-methoxybenzonitrile.
| Compound Name | 5-(4-amino-1,2-dihydroxybutyl)-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 171881743 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 5-(4-amino-1,2-dihydroxybutyl)-2-methoxybenzonitrile |
| SMILES | COc1ccc(C(O)C(O)CCN)cc1C#N |
| InChI | InChI=1S/C12H16N2O3/c1-17-11-3-2-8(6-9(11)7-14)12(16)10(15)4-5-13/h2-3,6,10,12,15-16H,4-5,13H2,1H3 |
| InChIKey | MGLMJQZRDFXLCZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |