C10H8BrF2NO2 — CID 107140527
5-(2-bromo-2,2-difluoro-1-hydroxyethyl)-2-methoxybenzonitrile (PubChem CID 107140527) has the molecular formula C10H8BrF2NO2 and a molecular weight of 292.08 g/mol. Its IUPAC name is 5-(2-bromo-2,2-difluoro-1-hydroxyethyl)-2-methoxybenzonitrile.
| Compound Name | 5-(2-bromo-2,2-difluoro-1-hydroxyethyl)-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 107140527 |
| Molecular Formula | C10H8BrF2NO2 |
| Molecular Weight | 292.08 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | 5-(2-bromo-2,2-difluoro-1-hydroxyethyl)-2-methoxybenzonitrile |
| SMILES | COc1ccc(C(O)C(F)(F)Br)cc1C#N |
| InChI | InChI=1S/C10H8BrF2NO2/c1-16-8-3-2-6(4-7(8)5-14)9(15)10(11,12)13/h2-4,9,15H,1H3 |
| InChIKey | IQOAZMDJJKICCX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.08 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|