C16H13F3N2O3 — CID 171255034
2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-hydroxy-4-methoxybenzonitrile (PubChem CID 171255034) has the molecular formula C16H13F3N2O3 and a molecular weight of 338.29 g/mol. Its IUPAC name is 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-hydroxy-4-methoxybenzonitrile.
| Compound Name | 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-hydroxy-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 171255034 |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3-hydroxy-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)c([C@@H](N)c2ccc(OC(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C16H13F3N2O3/c1-23-12-7-4-10(8-20)13(15(12)22)14(21)9-2-5-11(6-3-9)24-16(17,18)19/h2-7,14,22H,21H2,1H3/t14-/m0/s1 |
| InChIKey | MHMRKGUBZSIFCU-AWEZNQCLSA-N |
| XLogP | 3.22 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|