C13H12N2O2S — CID 171258373
2-[(S)-amino(thiophen-2-yl)methyl]-3-hydroxy-4-methoxybenzonitrile (PubChem CID 171258373) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 2-[(S)-amino(thiophen-2-yl)methyl]-3-hydroxy-4-methoxybenzonitrile.
| Compound Name | 2-[(S)-amino(thiophen-2-yl)methyl]-3-hydroxy-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 171258373 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2-[(S)-amino(thiophen-2-yl)methyl]-3-hydroxy-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)c([C@H](N)c2cccs2)c1O |
| InChI | InChI=1S/C13H12N2O2S/c1-17-9-5-4-8(7-14)11(13(9)16)12(15)10-3-2-6-18-10/h2-6,12,16H,15H2,1H3/t12-/m1/s1 |
| InChIKey | CISMUCNFPXZTOT-GFCCVEGCSA-N |
| XLogP | 2.38 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|