C15H20N2O2 — CID 171255026
2-[(S)-amino(cyclohexyl)methyl]-3-hydroxy-4-methoxybenzonitrile (PubChem CID 171255026) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-[(S)-amino(cyclohexyl)methyl]-3-hydroxy-4-methoxybenzonitrile.
| Compound Name | 2-[(S)-amino(cyclohexyl)methyl]-3-hydroxy-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 171255026 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-[(S)-amino(cyclohexyl)methyl]-3-hydroxy-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)c([C@@H](N)C2CCCCC2)c1O |
| InChI | InChI=1S/C15H20N2O2/c1-19-12-8-7-11(9-16)13(15(12)18)14(17)10-5-3-2-4-6-10/h7-8,10,14,18H,2-6,17H2,1H3/t14-/m0/s1 |
| InChIKey | WGTBINNXMJVHGH-AWEZNQCLSA-N |
| XLogP | 2.85 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|